CAS 6283-41-6
:1,3,4-trimethylpyridinium
Description:
1,3,4-Trimethylpyridinium is a quaternary ammonium compound characterized by a pyridine ring with three methyl groups attached at the 1, 3, and 4 positions. This structure contributes to its unique properties, including its solubility in polar solvents and its potential as a surfactant. The presence of the positively charged nitrogen atom enhances its reactivity and ability to form ionic interactions, making it useful in various chemical applications, including as a catalyst or in organic synthesis. It is typically encountered as a solid or in solution, and its stability is influenced by the surrounding environment, such as pH and temperature. Additionally, 1,3,4-trimethylpyridinium can exhibit antimicrobial properties, which may be leveraged in biocidal formulations. Safety data should be consulted for handling, as quaternary ammonium compounds can be irritants and may pose environmental hazards. Overall, 1,3,4-trimethylpyridinium is a versatile compound with applications in both industrial and research settings.
Formula:C8H12N
InChI:InChI=1/C8H12N/c1-7-4-5-9(3)6-8(7)2/h4-6H,1-3H3/q+1
SMILES:CC1C=CN(C)C=C1C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
