CAS 62838-65-7

1-(2-hydroxy-3-pyridyl)ethanone

Description:

1-(2-Hydroxy-3-pyridyl)ethanone, also known as 2-hydroxy-3-pyridineacetophenone, is an organic compound characterized by its pyridine ring and a ketone functional group. It features a hydroxyl group (-OH) attached to the pyridine ring, which contributes to its reactivity and potential for hydrogen bonding. The compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the hydroxyl group. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and condensation reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its unique structural features can influence its physical properties, such as melting point and boiling point, as well as its spectral characteristics in techniques like NMR and IR spectroscopy. Overall, 1-(2-hydroxy-3-pyridyl)ethanone is a versatile compound with applications in organic synthesis and potential therapeutic uses.

Formula: C₇H₇NO₂

InChI: InChI=1/C7H7NO2/c1-5(9)6-3-2-4-8-7(6)10/h2-4H,1H3,(H,8,10)

SMILES: CC(=O)c1cccnc1O

Synonyms:

• 2(1H)-pyridinone, 3-acetyl-
• 3-Acetylpyridin-2(1H)-one

2(1H)-Pyridinone, 3-acetyl- (9CI)

CAS: 62838-65-7

Formula: C₇H₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 137.1360

Ref: IN-DA00EFL1

3-Acetyl-2-hydroxypyridine

CAS: 62838-65-7

3-Acetyl-2-hydroxypyridine

Purity: 97%

Color and Shape: Beige Solid

Molecular weight: 137.14g/mol

Ref: 54-OR345384

3-Acetyl-2(1H)-pyridinone

CAS: 62838-65-7

Formula: C₇H₇NO₂

Purity: 98%

Color and Shape: Solid, Crystalline

Molecular weight: 137.138

Ref: 10-F093580