CAS 6284-74-8

N-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Description:

N-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by its pyrazolo and pyrimidine ring structures. It features a methyl group attached to the nitrogen atom of the pyrazole ring and an amino group at the 4-position of the pyrimidine moiety. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It exhibits potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The presence of both nitrogen-containing rings contributes to its unique chemical reactivity and potential interactions with biological targets. Additionally, its molecular structure allows for various modifications, which can enhance its pharmacological properties. As with many heterocycles, it may participate in hydrogen bonding and other interactions that are crucial for its biological function. Safety and handling precautions should be observed due to its potential toxicity and reactivity, as is standard with many chemical substances used in research and development.

Formula: C₆H₇N₅

InChI: InChI=1/C6H7N5/c1-7-5-4-2-10-11-6(4)9-3-8-5/h2-3H,1H3,(H2,7,8,9,10,11)

SMILES: CN=c1c2c[nH][nH]c2ncn1

N-Methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

CAS: 6284-74-8

Formula: C₆H₇N₅

Molecular weight: 149.1533

Ref: IN-DA00EXSC

N-Methyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

CAS: 6284-74-8

Versatile small molecule scaffold

Formula: C₆H₇N₅

Purity: Min. 95%

Molecular weight: 149.15 g/mol

Ref: 3D-GAA28474