CAS 6284-92-0
:3-hydroxy-4-methoxy-2-nitrobenzaldehyde
Description:
3-Hydroxy-4-methoxy-2-nitrobenzaldehyde, with the CAS number 6284-92-0, is an organic compound that belongs to the class of substituted benzaldehydes. It features a benzene ring with three functional groups: a hydroxyl group (-OH), a methoxy group (-OCH3), and a nitro group (-NO2), along with an aldehyde group (-CHO). This compound is typically characterized by its yellow to orange crystalline appearance and exhibits solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and potential applications in organic synthesis. Additionally, the hydroxyl and methoxy groups can participate in hydrogen bonding and affect the compound's polarity. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility as an intermediate in chemical synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks.
Formula:C8H7NO5
InChI:InChI=1/C8H7NO5/c1-14-6-3-2-5(4-10)7(8(6)11)9(12)13/h2-4,11H,1H3
SMILES:COc1ccc(C=O)c(c1O)N(=O)=O
Synonyms:- Benzaldehyde, 3-Hydroxy-4-Methoxy-2-Nitro-
- 3-Hydroxy-4-methoxy-2-nitrobenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-HYDROXY-4-METHOXY-2-NITRO-BENZALDEHYDE
CAS:Formula:C8H7NO5Purity:96%Color and Shape:SolidMolecular weight:197.14493-Hydroxy-4-methoxy-2-nitrobenzaldehyde
CAS:3-Hydroxy-4-methoxy-2-nitrobenzaldehydePurity:97%Molecular weight:197.14g/mol3-Hydroxy-4-methoxy-2-nitrobenzaldehyde
CAS:3-Hydroxy-4-methoxy-2-nitrobenzaldehyde is a ternary complex that has been adsorbed onto the surface of an ion exchange resin. The adsorption process occurs through the formation of hydrogen bonds between the hydroxyl groups on the resin and the hydroxyl groups on the molecule. This complex is also soluble in chloroform, which may be due to its ability to form hydrogen bonds with itself and other molecules. The 3-hydroxy group on this molecule has been shown to react reductively with nitrophenol, forming a nitroso derivative. 3-Hydroxy-4-methoxy-2-nitrobenzaldehyde has been used as a template for the microbiological assay of azides and quinones.Formula:C8H7NO5Purity:Min. 95%Molecular weight:197.14 g/mol



