CAS 62846-82-6

ethyl pyrimidine-4-carboxylate

Description:

Ethyl pyrimidine-4-carboxylate, identified by its CAS number 62846-82-6, is an organic compound characterized by the presence of a pyrimidine ring substituted with a carboxylate group and an ethyl ester. This compound typically exhibits a polar nature due to the carboxylate functional group, which can engage in hydrogen bonding and influence its solubility in polar solvents such as water and alcohols. Ethyl pyrimidine-4-carboxylate is often utilized in organic synthesis and medicinal chemistry, serving as a building block for various pharmaceuticals and agrochemicals. Its structure allows for potential reactivity in nucleophilic substitution reactions, making it valuable in the development of more complex molecules. Additionally, the compound may exhibit biological activity, which can be explored in drug discovery contexts. Overall, ethyl pyrimidine-4-carboxylate is a versatile compound with applications in both synthetic and medicinal chemistry.

Formula: C₇H₈N₂O₂

InChI: InChI=1/C7H8N2O2/c1-2-11-7(10)6-3-4-8-5-9-6/h3-5H,2H2,1H3

SMILES: CCOC(=O)c1ccncn1

Synonyms:

• 4-Pyrimidinecarboxylic acid, ethyl ester
• Ethyl 4-Pyrimidinecarboxylate

Ethyl Pyrimidine-4-carboxylate

CAS: 62846-82-6

Formula: C₇H₈N₂O₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Orange to Green powder to lump

Molecular weight: 152.15

Ref: 3B-E0881

4-​Pyrimidinecarboxylic acid, ethyl ester

CAS: 62846-82-6

Formula: C₇H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 152.1506

Ref: IN-DA00EAHV

Ethyl 4-pyrimidinecarboxylate

CAS: 62846-82-6

Ethyl 4-pyrimidinecarboxylate

Purity: 95%

Molecular weight: 152.15g/mol

Ref: 54-OR953072

Ethyl 4-pyrimidinecarboxylate

CAS: 62846-82-6

Formula: C₇H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.153

Ref: 10-F050163