CAS 6285-32-1
:1-[4-(1,1-Dimethylethyl)phenyl]-1-methylethyl hydroperoxide
Description:
1-[4-(1,1-Dimethylethyl)phenyl]-1-methylethyl hydroperoxide, with CAS number 6285-32-1, is an organic peroxide characterized by its hydroperoxide functional group. This compound features a tert-butyl group attached to a phenyl ring, which contributes to its stability and reactivity. It is typically a colorless to pale yellow liquid and is known for its potential as a radical initiator in polymerization reactions. The presence of the hydroperoxide group makes it susceptible to decomposition, especially under heat or in the presence of catalysts, releasing oxygen and potentially leading to explosive reactions if not handled properly. This compound is used in various industrial applications, including as a polymerization initiator and in the synthesis of other organic compounds. Safety precautions are essential when working with this substance due to its reactive nature and potential health hazards, including skin and respiratory irritation. Proper storage and handling protocols are crucial to mitigate risks associated with its use.
Formula:C13H20O2
InChI:InChI=1S/C13H20O2/c1-12(2,3)10-6-8-11(9-7-10)13(4,5)15-14/h6-9,14H,1-5H3
InChI key:InChIKey=HSYSVFXBQIIBBJ-UHFFFAOYSA-N
SMILES:C(OO)(C)(C)C1=CC=C(C(C)(C)C)C=C1
Synonyms:- p-tert-Butylcumene hydroperoxide
- p-t-Butylcumene hydroperoxide
- Hydroperoxide, 1-(4-(1,1-dimethylethyl)phenyl)-1-methylethyl
- Hydroperoxide, p-tert-butyl-alpha,alpha-dimethylbenzyl
- Hydroperoxide, 1-[4-(1,1-dimethylethyl)phenyl]-1-methylethyl
- 1-[4-(1,1-Dimethylethyl)phenyl]-1-methylethyl hydroperoxide
- Hydroperoxide, p-tert-butyl-α,α-dimethylbenzyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
p-tert-Butylcumene hydroperoxide
CAS:p-tert-Butylcumene hydroperoxide is a bioactive chemical.Formula:C13H20O2Color and Shape:SolidMolecular weight:208.301
