CAS 6285-64-9
:(3Z)-3-amino-3-imino-2-[(E)-phenyldiazenyl]propanamide
Description:
(3Z)-3-amino-3-imino-2-[(E)-phenyldiazenyl]propanamide, with the CAS number 6285-64-9, is a chemical compound characterized by its unique structural features. It contains an amino group, an imino group, and a phenyldiazenyl moiety, which contributes to its potential reactivity and biological activity. The presence of the diazenyl group indicates that it may exhibit azo-related properties, often associated with dyes and pigments. This compound is likely to be a solid at room temperature, with solubility varying depending on the solvent used, typically being more soluble in polar solvents due to the presence of functional groups capable of hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or as a reagent in organic synthesis. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to handle it under controlled conditions. Overall, (3Z)-3-amino-3-imino-2-[(E)-phenyldiazenyl]propanamide is a compound of interest in both synthetic and medicinal chemistry.
Formula:C9H11N5O
InChI:InChI=1/C9H11N5O/c10-8(11)7(9(12)15)14-13-6-4-2-1-3-5-6/h1-5,7H,(H3,10,11)(H2,12,15)/b14-13+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Amino-3-imino-2-(2-phenyldiazenyl)propanamide Hydrochloride
CAS:Formula:C9H12ClN5OPurity:96%Color and Shape:SolidMolecular weight:241.67753-Amino-3-imino-2-(2-phenyldiazenyl)propanamide Hydrochloride
CAS:Formula:C9H11N5O·HClMolecular weight:205.22 36.463-Amino-3-imino-2-(2-phenyldiazenyl)propanamide-d5 Hydrochloride
CAS:Formula:C9H6N5OD5·HClMolecular weight:210.25 36.463-Amino-3-imino-2-(2-phenyldiazenyl)propanamide Hydrochloride
CAS:Controlled ProductFormula:C9H11N5O·HClColor and Shape:NeatMolecular weight:241.6783-Amino-3-imino-2-(2-phenyldiazenyl)propanamide-d5 Hydrochloride
CAS:Controlled Product<p>Applications Isotope labelled 3-Amino-3-imino-2-(2-phenyldiazenyl)propanamide Hydrochloride is a Temozolomide (T017775) impurity. Temozolomide acts as a imidazotetrazine alkylating agent. An antineoplastic.<br>References Newlands, E.S., et al.: Cancer Treat. Rev., 23, 35 (1997), Kim, C., et al.: J. Biol. Chem., 274, 1233 (1999), Hait, W., et al.: Cancer Res., 69, 1263 (2009),<br></p>Formula:C9D5H6N5O·HClColor and Shape:NeatMolecular weight:246.708



