CAS 62855-40-7

1-Naphthalenecarboxylic acid, 4-formyl-, methyl ester

Description:

1-Naphthalenecarboxylic acid, 4-formyl-, methyl ester, also known as methyl 4-formyl-1-naphthoate, is an organic compound characterized by its naphthalene structure with a carboxylic acid and an aldehyde functional group. This compound typically appears as a solid or viscous liquid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. It features a methyl ester group, which contributes to its reactivity and potential applications in organic synthesis. The presence of both the aldehyde and carboxylic acid functionalities allows for various chemical transformations, making it useful in the synthesis of more complex molecules. Additionally, this compound may exhibit biological activity, although specific biological properties would depend on the context of its use. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₁₀O₃

InChI: InChI=1S/C13H10O3/c1-16-13(15)12-7-6-9(8-14)10-4-2-3-5-11(10)12/h2-8H,1H3

InChI key: InChIKey=RQODTKJVTXOAHI-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C2=C(C(C=O)=CC1)C=CC=C2

Synonyms:

• Methyl 4-formyl-1-naphthalenecarboxylate
• 1-Naphthalenecarboxylic acid, 4-formyl-, methyl ester
• Methyl 4-formyl-1-naphthoate

Methyl 4-formyl-1-naphthoate

CAS: 62855-40-7

Versatile small molecule scaffold

Formula: C₁₃H₁₀O₃

Purity: Min. 95%

Molecular weight: 214.22 g/mol

Ref: 3D-MCA85540