CAS 6286-46-0

2-bromo-4,5-dimethoxybenzoic acid

Description:

2-Bromo-4,5-dimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two methoxy groups attached to a benzoic acid framework. The molecular structure features a benzene ring substituted at the 2-position with a bromine atom and at the 4- and 5-positions with methoxy groups (-OCH3). This compound is typically a white to off-white solid and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the aromatic system. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the methoxy groups can influence the compound's reactivity and polarity, affecting its interactions in biological systems and synthetic applications. 2-Bromo-4,5-dimethoxybenzoic acid is often utilized in organic synthesis and medicinal chemistry, serving as an intermediate in the preparation of more complex molecules.

Formula: C₉H₉BrO₄

InChI: InChI=1/C9H9BrO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,1-2H3,(H,11,12)

SMILES: COc1cc(c(cc1OC)Br)C(=O)O

2-Bromo-4,5-dimethoxybenzoic Acid

CAS: 6286-46-0

Formula: C₉H₉BrO₄

Purity: >98.0%(T)(HPLC)

Color and Shape: White to Orange to Green powder to crystal

Molecular weight: 261.07

Ref: 3B-B3891

2-Bromo-4,5-dimethoxybenzoic acid

CAS: 6286-46-0

Formula: C₉H₉BrO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 261.0694

Ref: IN-DA00EAFL

2-Bromo-4,5-dimethoxybenzoic acid

CAS: 6286-46-0

2-Bromo-4,5-dimethoxybenzoic acid

Formula: C₉H₉BrO₄

Purity: 98%

Color and Shape: white solid

Molecular weight: 261.07g/mol

Ref: 54-OR4517

2-Bromo-4,5-dimethoxybenzoic Acid

Controlled Product

CAS: 6286-46-0

Applications 2-Bromo-4,5-dimethoxybenzoic Acid (cas# 6286-46-0) is a compound useful in organic synthesis.

Formula: C₉H₉BrO₄

Color and Shape: Neat

Molecular weight: 261.07

Ref: TR-B684055

2-Bromo-4,5-dimethoxybenzoic acid

CAS: 6286-46-0

Formula: C₉H₉BrO₄

Purity: 98%

Color and Shape: Beige powder

Molecular weight: 261.071

Ref: 10-F018269

2-Bromo-4,5-dimethoxybenzoic acid

CAS: 6286-46-0

2-Bromo-4,5-dimethoxybenzoic acid is a synthetic compound that belongs to the group of anticancer drugs. It is a potent inhibitor of mitochondrial membrane depolarization and has been shown to inhibit tumor growth in vivo. 2-Bromo-4,5-dimethoxybenzoic acid also induces cell death by demethylation and hydroxylation of DNA, leading to apoptosis. This compound is synthesized by reacting 3,4-dihydroxybenzoic acid with bromine and potassium hydroxide. Surrogates such as amides are used for this synthesis because the original product is not stable enough. Protocatechuic acid can be produced from 2-bromo-4,5-dimethoxybenzoic acid through hydrolysis.

Formula: C₉H₉BrO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 261.07 g/mol

Ref: 3D-FB19136