
CAS 62867-47-4
:Fumigaclavine C
Description:
Fumigaclavine C is a naturally occurring alkaloid belonging to the class of compounds known as fumigaclavines, which are derived from certain fungi, particularly those in the genus Aspergillus. This compound is characterized by its complex bicyclic structure, which includes a fused indole and isoquinoline moiety. Fumigaclavine C exhibits notable biological activities, including antimicrobial and potential anticancer properties, making it of interest in pharmaceutical research. Its molecular formula typically includes carbon, hydrogen, nitrogen, and oxygen atoms, reflecting its organic nature. The compound is often studied for its role in the biosynthesis of other alkaloids and its ecological significance in fungal metabolism. Additionally, due to its unique structure, fumigaclavine C may serve as a lead compound for the development of new therapeutic agents. However, detailed studies on its pharmacokinetics, toxicity, and mechanism of action are essential for understanding its full potential in medicinal chemistry.
Formula:C23H30N2O2
InChI:InChI=1S/C23H30N2O2/c1-7-23(4,5)22-16-11-18-20(15-9-8-10-17(24-22)19(15)16)21(27-14(3)26)13(2)12-25(18)6/h7-10,13,18,20-21,24H,1,11-12H2,2-6H3/t13-,18+,20+,21-/m0/s1
InChI key:InChIKey=OSICWVVWEXKSBD-LFAYTRTRSA-N
SMILES:C(C=C)(C)(C)C1=C2C=3C([C@@]4([C@@](C2)(N(C)C[C@H](C)[C@@H]4OC(C)=O)[H])[H])=CC=CC3N1
Synonyms:- Ergolin-9-ol, 2-(1,1-dimethyl-2-propenyl)-6,8-dimethyl-, acetate (ester), (8β,9β)-
- Indolo[4,3-fg]quinoline, ergolin-9-ol deriv.
- Fumigaclavine C
- Ergolin-9-ol, 2-(1,1-dimethyl-2-propen-1-yl)-6,8-dimethyl-, 9-acetate, (8β,9β)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fumigaclavine C
CAS:<p>Fumigaclavine C is a useful organic compound for research related to life sciences. The catalog number is T124517 and the CAS number is 62867-47-4.</p>Formula:C23H30N2O2Color and Shape:SolidMolecular weight:366.505
