CAS 628692-15-9
:2-Methoxypyrimidine-5-boronic acid
Description:
2-Methoxypyrimidine-5-boronic acid is an organic compound characterized by the presence of a pyrimidine ring substituted with a methoxy group and a boronic acid functional group. The molecular structure features a six-membered aromatic ring containing nitrogen atoms, which contributes to its heterocyclic nature. The methoxy group (-OCH3) enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The boronic acid moiety (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including medicinal chemistry and materials science. This compound is often utilized in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, its unique properties may allow for potential applications in drug development and as a building block in the synthesis of more complex molecules. Overall, 2-Methoxypyrimidine-5-boronic acid is a versatile compound with significant implications in both research and industrial contexts.
Formula:C5H7BN2O3
InChI:InChI=1/C5H7BN2O3/c1-11-5-7-2-4(3-8-5)6(9)10/h2-3,9-10H,1H3
SMILES:COc1ncc(cn1)B(O)O
Synonyms:- (2-Methoxy-5-pyrimidinyl)boronic acid
- (2-Methoxypyrimidin-5-yl)boronic acid
- Boronic acid, B-(2-methoxy-5-pyrimidinyl)-
- 2-Methoxy-5-Pyrimidineboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Methoxy-5-pyrimidylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H7BN2O3Color and Shape:White to Light yellow powder to crystalMolecular weight:153.93Boronic acid, (2-methoxy-5-pyrimidinyl)-
CAS:Formula:C5H7BN2O3Purity:98%Color and Shape:SolidMolecular weight:153.93172-Methoxypyrimidine-5-boronic acid
CAS:<p>2-Methoxypyrimidine-5-boronic acid</p>Formula:C5H7BN2O3Purity:≥95%Color and Shape: faint to light yellow solidMolecular weight:153.93g/mol2-Methoxypyrimidine-5-boronic acid
CAS:Formula:C5H7BN2O3Purity:98%Color and Shape:SolidMolecular weight:153.932-Methoxypyrimidine-5-boronic acid
CAS:<p>Please enquire for more information about 2-Methoxypyrimidine-5-boronic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C5H7BN2O3Purity:Min. 95%Molecular weight:153.93 g/mol





