CAS 628692-17-1

B-Benzo[b]thien-7-ylboronic acid

Description:

B-Benzo[b]thien-7-ylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a benzo[b]thienyl moiety. This compound typically exhibits properties associated with both boronic acids and aromatic heterocycles. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The benzo[b]thienyl structure contributes to its aromatic stability and potential electronic properties, which can be advantageous in materials science and organic electronics. Additionally, compounds like B-Benzo[b]thien-7-ylboronic acid may exhibit interesting biological activities, making them candidates for further research in drug development. Its solubility and reactivity can vary based on the specific conditions and solvents used, which is important for its application in synthetic pathways or biological assays. Overall, this compound represents a versatile building block in both organic synthesis and potential pharmaceutical applications.

Formula: C₈H₇BO₂S

InChI: InChI=1S/C8H7BO2S/c10-9(11)7-3-1-2-6-4-5-12-8(6)7/h1-5,10-11H

InChI key: InChIKey=RVFILKCRCVFHPV-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C2C(C=CS2)=CC=C1

Synonyms:

• (Benzo[b]thien-7-yl)boronic acid
• 1-Benzothien-7-ylboronicacid
• B-Benzo[b]thien-7-ylboronic acid
• Benzo[b]thiophen-7-ylboronic acid
• Benzothien-7-ylboronic acid
• Boronic acid, benzo[b]thien-7-yl-
• boronic acid, B-benzo[b]thien-7-yl-

1-benzothien-7-ylboronic acid

CAS: 628692-17-1

Formula: C₈H₇BO₂S

Purity: 96%

Color and Shape: Solid

Molecular weight: 178.0160

Ref: IN-DA00EDB7

1-Benzothiophen-7-ylboronic acid

CAS: 628692-17-1

1-Benzothiophen-7-ylboronic acid

Purity: 97%

Molecular weight: 178.02g/mol

Ref: 54-OR360319

7-Benzothiopheneboronic acid

CAS: 628692-17-1

Formula: C₈H₇BO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 178.01

Ref: 10-F032476