CymitQuimica logo

CAS 628692-21-7

:

1,3,2-Dioxaborolane, 2-(2-fluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl-

Description:
1,3,2-Dioxaborolane, 2-(2-fluoro-4-methoxyphenyl)-4,4,5,5-tetramethyl- is a boron-containing heterocyclic compound characterized by its dioxaborolane ring structure, which features a five-membered cyclic arrangement containing two oxygen atoms and one boron atom. This compound exhibits unique properties due to the presence of the boron atom, which can participate in various chemical reactions, including those involving nucleophiles and electrophiles. The presence of the 2-fluoro-4-methoxyphenyl substituent enhances its reactivity and solubility in organic solvents, making it useful in synthetic organic chemistry. Additionally, the tetramethyl groups contribute to steric hindrance, influencing the compound's reactivity and stability. This compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases.
Formula:C13H18BFO3
InChI:InChI=1S/C13H18BFO3/c1-12(2)13(3,4)18-14(17-12)10-7-6-9(16-5)8-11(10)15/h6-8H,1-5H3
InChI key:PYGFGOBGKWJERN-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC)F
Synonyms:
  • 2-Fluoro-4-Methoxyphenylboronic acid pinacol ester
Found 4 products.