CAS 6287-82-7

2,3-dibromo-1-benzothiophene

Description:

2,3-Dibromo-1-benzothiophene is an organic compound characterized by the presence of a benzothiophene ring system, which consists of a fused benzene and thiophene ring, with two bromine substituents at the 2 and 3 positions. This compound typically exhibits a pale yellow to brownish color and is known for its aromatic properties, which contribute to its stability and reactivity. The bromine atoms enhance its electrophilic character, making it useful in various chemical reactions, including electrophilic substitution. It is generally insoluble in water but soluble in organic solvents such as dichloromethane and acetone. The presence of the thiophene ring imparts unique electronic properties, making it of interest in materials science, particularly in organic electronics and photonic applications. Additionally, 2,3-dibromo-1-benzothiophene may exhibit biological activity, which warrants further investigation for potential applications in pharmaceuticals or agrochemicals. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts.

Formula: C₈H₄Br₂S

InChI: InChI=1/C8H4Br2S/c9-7-5-3-1-2-4-6(5)11-8(7)10/h1-4H

SMILES: c1ccc2c(c1)c(c(Br)s2)Br

Synonyms:

• Benzo(b)thiophene, 2,3-dibromo-

2,3-Dibromobenzo[b]thiophene

CAS: 6287-82-7

Formula: C₈H₄Br₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 291.9904

Ref: IN-DA0032XI

2,3-Dibromobenzo[b]thiophene

CAS: 6287-82-7

2,3-Dibromobenzo[b]thiophene

Purity: 98%

Molecular weight: 292.00g/mol

Ref: 54-OR74477

2,3-Dibromobenzo[b]thiophene

CAS: 6287-82-7

Formula: C₈H₄Br₂S

Purity: >98.0%(GC)

Color and Shape: White to Light yellow to Dark green powder to crystal

Molecular weight: 291.99

Ref: 3B-D5604

2,3-Dibromobenzo[b]thiophene

CAS: 6287-82-7

Formula: C₈H₄Br₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 291.99

Ref: 10-F224824