CAS 62882-00-2
:8-Methylisoquinoline
Description:
8-Methylisoquinoline is an organic compound classified as a heterocyclic aromatic compound. It features a fused ring structure consisting of a benzene ring and a pyridine ring, with a methyl group attached to the isoquinoline framework at the 8-position. This compound is typically a pale yellow to brown liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. 8-Methylisoquinoline can exhibit properties such as fluorescence and may participate in various chemical reactions, including electrophilic substitutions and nucleophilic additions. Its solubility varies in different solvents, and it is generally stable under standard conditions. However, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 8-Methylisoquinoline serves as an important building block in organic synthesis and research within the field of chemistry.
Formula:C10H9N
InChI:InChI=1S/C10H9N/c1-8-3-2-4-9-5-6-11-7-10(8)9/h2-7H,1H3
InChI key:InChIKey=IEZFKBBOGATCFW-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=CC1)C=CN=C2
Synonyms:- 8-Methyl-Isoquinoline
- Isoquinoline, 8-methyl-
- 8-Methylisoquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.