CAS 6289-46-9
:Dimethyl succinylsuccinate
Description:
Dimethyl succinylsuccinate, with the CAS number 6289-46-9, is an organic compound characterized by its structure, which features two succinate units connected by a dimethyl ester group. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water due to its hydrophobic characteristics. Dimethyl succinylsuccinate is known for its applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its chemical properties include the ability to undergo hydrolysis, leading to the formation of succinic acid and methanol under certain conditions. Additionally, it may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Overall, dimethyl succinylsuccinate serves as a versatile building block in chemical synthesis, contributing to the development of more complex molecules in various fields.
Formula:C10H12O6
InChI:InChI=1S/C10H12O6/c1-15-9(13)5-3-8(12)6(4-7(5)11)10(14)16-2/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=MHKKFFHWMKEBDW-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1C(=O)CC(C(OC)=O)C(=O)C1
Synonyms:- 1,4-Cyclohexanedicarboxylic acid, 2,5-dioxo-, 1,4-dimethyl ester
- 1,4-Cyclohexanedicarboxylic acid, 2,5-dioxo-, dimethyl ester
- 1,4-Dimethyl 2,5-dioxocyclohexane-1,4-dicarboxylate
- 2,5-Dioxo-1,4-Cyclohexanedicarboxylic Acid Dimethyl Ester
- Dimethyl 2,5-Dioxocyclohexane-1,4-Dicarboxylate
- Dimethyl 2,5-dioxocyclohexane-1,4-carboxylate
- Dimethyl cyclohexane-2,5-dione-1,4-dicarboxylate
- Dimethyl succinosuccinate
- Dimethyl succinylosuccinate
- Dimethyl succinylsuccinate
- Dmss
- NSC 122567
- NSC 5670
- Succinosuccinic acid dimethyl ester
- dimethyl (1R,4R)-2,5-dioxocyclohexane-1,4-dicarboxylate
- dimethyl (1R,4S)-2,5-dioxocyclohexane-1,4-dicarboxylate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dimethyl 1,4-Cyclohexanedione-2,5-dicarboxylate
CAS:Formula:C10H12O6Purity:>95.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:228.20Dimethyl 1,4-cyclohexanedione-2,5-dicarboxylate, 99+%
CAS:Dimethyl 1,4-cyclohexanedione-2,5-dicarboxylate is used in the production of pigments such as pigment red 122 and pigment violet 19. It also can react with 2,4-diamino-phenol to get 2,5-bis-(3-amino-4-hydroxy-phenylamino)-cyclohexa-1,4-diene-1,4-dicarboxylic acid dimethyl ester. This Thermo Scientif
Formula:C10H12O6Purity:99+%Color and Shape:Crystals or powder or crystalline powder, White to pale cream to pale yellow or yellow-greenMolecular weight:228.20Dimethyl 2,5-dioxocyclohexane-1,4-dicarboxylate
CAS:Formula:C10H12O6Purity:98%Color and Shape:SolidMolecular weight:228.1987Dimethyl 2,5-dioxocyclohexane-1,4-dicarboxylate
CAS:Dimethyl 2,5-dioxocyclohexane-1,4-dicarboxylatePurity:98%Molecular weight:228.20g/molDimethyl 2,5-dioxocyclohexane-1,4-dicarboxylate
CAS:Formula:C10H12O6Purity:98%Color and Shape:Solid, White to slightly pale yellow green powderMolecular weight:228.2




