CAS 629-22-1
:2-Hydroxystearic acid
Description:
2-Hydroxystearic acid, with the CAS number 629-22-1, is a fatty acid characterized by the presence of a hydroxyl group at the second carbon position of the stearic acid chain. This compound is a white, waxy solid at room temperature and is soluble in organic solvents but has limited solubility in water due to its long hydrophobic hydrocarbon chain. It exhibits properties typical of fatty acids, including the ability to form emulsions and act as a surfactant. The hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, such as esterification and oxidation. 2-Hydroxystearic acid is utilized in various applications, including cosmetics, lubricants, and as an additive in food and pharmaceuticals. Its unique structure also makes it a subject of interest in research related to biodegradable materials and surfactants. Overall, 2-hydroxystearic acid is valued for its functional properties and versatility in industrial applications.
Formula:C18H36O3
InChI:InChI=1S/C18H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h17,19H,2-16H2,1H3,(H,20,21)
InChI key:InChIKey=KIHBGTRZFAVZRV-UHFFFAOYSA-N
SMILES:C(CCC(C(O)=O)O)CCCCCCCCCCCCC
Synonyms:- (2R)-2-hydroxyoctadecanoic acid
- (±)-α-Hydroxystearic acid
- 2-Hydroxyoctadecanoic acid
- 2-Hydroxystearic acid
- <span class="text-smallcaps">DL</span>-2-Hydroxystearic acid
- NSC 907
- Octadecanoic acid, 2-hydroxy-
- Stearic acid, α-hydroxy-
- alpha-Hydroxystearic acid
- α-Hydroxyoctadecanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Hydroxystearic acid
CAS:2-Hydroxystearic acid, in humans and U. armoricana, inhibits EAT cell growth in vitro at 100 μM.Formula:C18H36O3Purity:99.16%Color and Shape:SolidMolecular weight:300.482-Hydroxyoctadecanoic acid
CAS:Formula:C18H36O3Purity:>98%Color and Shape:SolidMolecular weight:300.482-Hydroxystearic Acid
CAS:Controlled ProductFormula:C18H36O3Color and Shape:NeatMolecular weight:300.4772-Hydroxystearic acid
CAS:2-Hydroxystearic acid is a fatty acid that is found in natural fats and oils. It can be synthesized from stearic acid by the oxidation of the hydroxyl group to an alcohol. 2-Hydroxystearic acid has a hydroxyl group, which gives it hydrogen bonding ability. This chemical species can also react with an antimicrobial peptide, forming a complex that is more effective at killing bacteria than either component alone. The magnetic properties of 2-hydroxystearic acid make it an excellent candidate for use in magnetic particle imaging (MPI) to reveal structural information about brain tissue. 2-Hydroxystearic acid also has high values when chromatographically analyzed.
Formula:C18H36O3Purity:Min. 95%Molecular weight:300.48 g/mol





