CAS 6291-07-2

5-chloronaphthalene-1-sulfonyl chloride

Description:

5-Chloronaphthalene-1-sulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group attached to a chlorinated naphthalene ring. It typically appears as a solid or crystalline substance and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the sulfonyl chloride group. This compound is often used as an intermediate in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. Its chlorinated naphthalene structure contributes to its hydrophobic properties, making it less soluble in water but soluble in organic solvents. The presence of the chlorine atom enhances its electrophilic character, allowing it to participate in various chemical reactions. Safety precautions are necessary when handling this compound, as it can be corrosive and may release toxic gases upon reaction with water or other nucleophiles. Overall, 5-chloronaphthalene-1-sulfonyl chloride is a valuable reagent in synthetic organic chemistry.

Formula: C₁₀H₆Cl₂O₂S

InChI: InChI=1/C10H6Cl2O2S/c11-9-5-1-4-8-7(9)3-2-6-10(8)15(12,13)14/h1-6H

SMILES: c1cc2c(cccc2S(=O)(=O)Cl)c(c1)Cl

5-Chloronaphthalene-1-sulphonyl chloride

CAS: 6291-07-2

5-Chloronaphthalene-1-sulphonyl chloride

Formula: C₁₀H₆Cl₂O₂S

Purity: ≥95%

Color and Shape: pale yellow solid

Molecular weight: 261.12g/mol

Ref: 54-OR7100T

5-Chloronaphthalene-1-sulfonyl Chloride

Controlled Product

CAS: 6291-07-2

Applications 5-Chloronaphthalene-1-sulfonyl Chloride (cas# 6291-07-2) is a compound useful in organic synthesis.

Formula: C₁₀H₆Cl₂O₂S

Color and Shape: Neat

Molecular weight: 261.12

Ref: TR-C371000

5-Chloronaphthalene-1-sulfonyl chloride

CAS: 6291-07-2

Purity: 98%

Molecular weight: 261.1199951

Ref: 10-F722093