CAS 6291-23-2
:4-(Morpholin-4-yl)phenol
Description:
4-(Morpholin-4-yl)phenol, with the CAS number 6291-23-2, is an organic compound characterized by the presence of a phenolic group and a morpholine ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the hydroxyl group and the morpholine moiety, which can engage in hydrogen bonding. The morpholine ring contributes to its basicity and potential reactivity, making it useful in various chemical applications, including as a building block in pharmaceuticals and agrochemicals. The compound may exhibit biological activity, including antimicrobial or antifungal properties, which can be attributed to its structural features. Additionally, it may serve as an intermediate in organic synthesis or as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c12-10-3-1-9(2-4-10)11-5-7-13-8-6-11/h1-4,12H,5-8H2
InChI key:InChIKey=GPPRMDWJKBFBMZ-UHFFFAOYSA-N
SMILES:OC1=CC=C(C=C1)N2CCOCC2
Synonyms:- 4-(4-Hydroxyphenyl)morpholine
- 4-(4-Morpholino)Phenol
- 4-(4-Morpholinyl)phenol
- 4-(Morpholin-4-Yl)Phenol
- 4-(Morpholino)phenol
- 4-(N-Morpholino)-phenol
- N-(4-Hydroxyphenyl)morpholine
- N-(p-Hydroxyphenyl)morpholine
- NSC 4800
- Phenol, 4-(4-morpholinyl)-
- Phenol, p-morpholino-
- p-Hydroxyphenylmorpholine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Morpholin-4-yl-phenol
CAS:<p>4-Morpholin-4-yl-phenol</p>Formula:C10H13NO2Purity:97%Color and Shape: off-white solidMolecular weight:179.22g/mol4-Morpholin-4-yl-phenol
CAS:<p>4-Morpholin-4-yl-phenol is a molecule that belongs to the class of organic compounds called morpholines. It is an intermediate in the formation of 4-morpholinoaniline. In this reaction, a nucleophilic oxygen atom (OH) reacts with an electrophilic nitrogen atom (N) and forms a tetrahedral intermediate. This intermediate then undergoes dimerization, which results in the loss of water molecules and produces a double bond between carbon atoms 3 and 4. The product of this reaction is 4-morpholin-4-yl phenol. <br>The kinetics of this reaction are first order with respect to both reactants. The rate constant for this reaction is 0.0029 mol/L/s at 25°C and can be calculated from the equation:<br>k = A[R]*[S]/(R*S)<br>where A is the concentration of R and S is the concentration of S</p>Formula:C10H13NO2Purity:Min. 95%Molecular weight:179.22 g/mol



