CAS 6291-42-5
:B-lactose octaacetate
Description:
B-lactose octaacetate, with the CAS number 6291-42-5, is a derivative of lactose, specifically an acetylated form. This compound is characterized by the presence of eight acetyl groups attached to the hydroxyl groups of the lactose molecule, which significantly alters its physical and chemical properties compared to unmodified lactose. B-lactose octaacetate is typically a white to off-white solid, and it is soluble in organic solvents such as chloroform and acetone, but less soluble in water due to the hydrophobic nature imparted by the acetyl groups. The acetylation process enhances the stability and shelf-life of the compound, making it useful in various applications, including pharmaceuticals and food science. Additionally, the modification can influence the compound's reactivity and interaction with biological systems, which is of interest in research related to drug delivery and formulation. Overall, B-lactose octaacetate serves as an important compound in the study of carbohydrate chemistry and its applications in various fields.
Formula:C28H38O19
InChI:InChI=1/C28H38O19/c1-11(29)37-9-19-21(39-13(3)31)23(40-14(4)32)26(43-17(7)35)28(46-19)47-22-20(10-38-12(2)30)45-27(44-18(8)36)25(42-16(6)34)24(22)41-15(5)33/h19-28H,9-10H2,1-8H3/t19-,20-,21+,22-,23+,24+,25-,26-,27-,28+/m1/s1
Synonyms:- beta-Lactose Octaacetate
- 1,2,3,6-tetra-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl-beta-D-galactopyranosyl)-beta-D-glucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Lactose octaacetate, 98%
CAS:Lactose octaacetate is used as pharmaceutical intermediates. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference haFormula:C28H38O19Purity:98%Color and Shape:White to off-white, PowderMolecular weight:678.59Lactose Octaacetate
CAS:Formula:C28H38O19Purity:>95.0%(HPLC)(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:678.59Lactose octaacetate
CAS:Formula:C28H38O19Purity:≥ 97.5%Color and Shape:White to off-white powderMolecular weight:678.59Lactose Octaacetate
CAS:Controlled ProductApplications Lactose Octaacetate (cas# 6291-42-5) is a compound useful in organic synthesis.
Formula:C28H38O19Color and Shape:NeatMolecular weight:678.59






