CAS 6292-61-1

4-chloronaphthalene-1-sulfonamide

Description:

4-Chloronaphthalene-1-sulfonamide is an organic compound characterized by its sulfonamide functional group attached to a chlorinated naphthalene ring system. It typically appears as a solid, often white to off-white in color, and is known for its moderate solubility in organic solvents while being less soluble in water. The presence of the sulfonamide group imparts certain biological activities, making it of interest in pharmaceutical applications, particularly as a potential antimicrobial agent. The chlorine substituent on the naphthalene ring can influence the compound's reactivity and interaction with biological systems. Additionally, 4-chloronaphthalene-1-sulfonamide may exhibit properties such as stability under standard conditions, but it should be handled with care due to potential toxicity associated with sulfonamide compounds. As with many organic chemicals, proper safety measures should be observed when working with this substance, including the use of personal protective equipment and adherence to relevant safety guidelines.

Formula: C₁₀H₈ClNO₂S

InChI: InChI=1/C10H8ClNO2S/c11-9-5-6-10(15(12,13)14)8-4-2-1-3-7(8)9/h1-6H,(H2,12,13,14)

SMILES: c1ccc2c(c1)c(ccc2S(=O)(=O)N)Cl

4-Chloronaphthalene-1-sulfonamide

CAS: 6292-61-1

Versatile small molecule scaffold

Formula: C₁₀H₈ClNO₂S

Purity: Min. 95%

Molecular weight: 241.69 g/mol

Ref: 3D-GAA29261