CAS 6292-67-7
:6-hydrazinyl-6-oxohexanoic acid
Description:
6-Hydrazinyl-6-oxohexanoic acid, with the CAS number 6292-67-7, is an organic compound characterized by the presence of a hydrazine functional group and a carboxylic acid moiety. This compound features a six-carbon chain with a ketone group at the sixth position, which contributes to its reactivity and potential applications in various chemical syntheses. The hydrazine group imparts unique properties, making it useful in the synthesis of hydrazones and other derivatives. Typically, compounds like this exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid, while the hydrazine group can participate in various chemical reactions, including condensation and redox reactions. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. However, specific safety and handling guidelines should be followed, as hydrazine derivatives can be toxic and potentially hazardous. Overall, 6-hydrazinyl-6-oxohexanoic acid serves as a versatile building block in organic chemistry and medicinal chemistry.
Formula:C6H12N2O3
InChI:InChI=1/C6H12N2O3/c7-8-5(9)3-1-2-4-6(10)11/h1-4,7H2,(H,8,9)(H,10,11)
SMILES:C(CCC(=O)O)CC(=NN)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Monohydrazide Adipic Acid
CAS:Controlled ProductApplications Monohydrazide Adipic Acid is a synthetic reagent and a plant growth retarding agent.
References Ye, W-L., et al.: J. Pharm. Sci, 104, 2293-2303 (2015);Formula:C6H12N2O3Color and Shape:Off-WhiteMolecular weight:160.17
