CAS 6292-69-9

3-(Phenylthio)propanoic acid hydrazide

Description:

3-(Phenylthio)propanoic acid hydrazide, identified by its CAS number 6292-69-9, is an organic compound characterized by the presence of a hydrazide functional group attached to a propanoic acid moiety, which is further substituted with a phenylthio group. This compound typically appears as a solid and is soluble in polar organic solvents. Its structure includes a hydrazine linkage (-NH-NH2) that contributes to its reactivity, particularly in condensation reactions and potential applications in medicinal chemistry. The phenylthio group enhances the compound's lipophilicity, which may influence its biological activity and interactions with other molecules. Additionally, the presence of both hydrazide and thioether functionalities suggests potential for diverse chemical reactivity, including the formation of hydrazones and thioether derivatives. Overall, 3-(Phenylthio)propanoic acid hydrazide is of interest in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features and potential applications in drug development and synthesis.

Formula: C₉H₁₂N₂OS

InChI: InChI=1S/C9H12N2OS/c10-11-9(12)6-7-13-8-4-2-1-3-5-8/h1-5H,6-7,10H2,(H,11,12)

InChI key: InChIKey=CKHPOCWCCXUBPP-UHFFFAOYSA-N

SMILES: S(CCC(NN)=O)C1=CC=CC=C1

Synonyms:

• Propionic acid, 3-(phenylthio)-, hydrazide
• 3-(Phenylthio)propanoic acid hydrazide
• Propanoic acid, 3-(phenylthio)-, hydrazide
• 3-Phenylsulfanylpropanehydrazide
• NSC 9928