CymitQuimica logo

CAS 62924-31-6

:

3-Buten-2-one, 4-(4-methoxy-2,3,6-trimethylphenyl)-, (E)-

Description:
3-Buten-2-one, 4-(4-methoxy-2,3,6-trimethylphenyl)-, (E)-, also known by its CAS number 62924-31-6, is an organic compound characterized by its conjugated double bond system and a methoxy-substituted aromatic ring. This compound features a butenone backbone, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. The (E)- configuration indicates that the highest priority substituents on the double bond are on opposite sides, which can affect the compound's physical properties, such as boiling point and stability. Additionally, the presence of multiple methyl groups on the aromatic ring contributes to steric hindrance, potentially impacting its reactivity and interactions with other molecules. Overall, this compound may be of interest in fields such as materials science, pharmaceuticals, and organic chemistry due to its unique structural features.
Formula:C14H18O2
InChI:InChI=1S/C14H18O2/c1-9-8-14(16-5)12(4)11(3)13(9)7-6-10(2)15/h6-8H,1-5H3/b7-6+
InChI key:InChIKey=NMRRLIHKRCVLLQ-VOTSOKGWSA-N
SMILES:C(=C/C(C)=O)\C1=C(C)C(C)=C(OC)C=C1C
Synonyms:
  • (E)-4-[4-Methoxy-2,3,6-trimethylphenyl]-3-buten-2-one
  • 3-Buten-2-one, 4-(4-methoxy-2,3,6-trimethylphenyl)-, (E)-
Found 0 products.