CAS 62935-73-3

Methyl 7-methoxy-2-oxo-2H-1-benzopyran-4-acetate

Description:

Methyl 7-methoxy-2-oxo-2H-1-benzopyran-4-acetate, with the CAS number 62935-73-3, is a chemical compound belonging to the class of benzopyran derivatives. This substance features a benzopyran core, which is characterized by a fused benzene and pyran ring structure, contributing to its aromatic properties. The presence of a methoxy group at the 7-position enhances its solubility and reactivity, while the 2-oxo group indicates a carbonyl functionality that can participate in various chemical reactions, such as nucleophilic attacks. The acetate moiety suggests that the compound can undergo hydrolysis, releasing acetic acid and potentially forming a corresponding alcohol. Methyl 7-methoxy-2-oxo-2H-1-benzopyran-4-acetate may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features may contribute to antioxidant, anti-inflammatory, or other therapeutic properties, although specific biological activities would require further investigation. Overall, this compound exemplifies the diverse chemistry of flavonoid-like structures and their potential applications in various fields.

Formula: C₁₃H₁₂O₅

InChI: InChI=1S/C13H12O5/c1-16-9-3-4-10-8(5-12(14)17-2)6-13(15)18-11(10)7-9/h3-4,6-7H,5H2,1-2H3

InChI key: InChIKey=IEMSTXMWFNGNTK-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C=1C=2C(=CC(OC)=CC2)OC(=O)C1

Synonyms:

• Methyl 7-methoxy-2-oxo-2H-1-benzopyran-4-acetate
• 2H-1-Benzopyran-4-acetic acid, 7-methoxy-2-oxo-, methyl ester