CAS 62937-96-6
:1-(ethylsulfonyl)piperazine
Description:
1-(Ethylsulfonyl)piperazine is an organic compound characterized by the presence of a piperazine ring, which is a six-membered cyclic amine containing two nitrogen atoms. The ethylsulfonyl group attached to the piperazine enhances its solubility in polar solvents and may influence its biological activity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The presence of the sulfonyl group can also impart unique reactivity, making it a useful intermediate in organic synthesis. Additionally, 1-(ethylsulfonyl)piperazine may exhibit specific pharmacological properties, which are of interest in drug discovery and development. As with many chemical substances, safety and handling precautions should be observed, as it may pose health risks if not managed properly.
Formula:C6H14N2O2S
InChI:InChI=1/C6H14N2O2S/c1-2-11(9,10)8-5-3-7-4-6-8/h7H,2-6H2,1H3
SMILES:CCS(=O)(=O)N1CCNCC1
Synonyms:- Piperazine, 1-(ethylsulfonyl)-
- 1-(Ethylsulfonyl)piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(Ethanesulfonyl)piperazine
CAS:Formula:C6H14N2O2SPurity:98%Color and Shape:SolidMolecular weight:178.25261-(Ethylsulphonyl)piperazine
CAS:1-(Ethylsulphonyl)piperazineFormula:C6H14N2O2SPurity:95%Color and Shape: colourless solidMolecular weight:178.25g/mol1-Ethylsulfonyl-piperazine
CAS:Formula:C6H14N2O2SPurity:98%Color and Shape:Solid, OilMolecular weight:178.251-(Ethanesulfonyl)piperazine
CAS:1-(Ethanesulfonyl)piperazine is an oxidation product of ethylsulfonyl. It is used to inhibit the synthesis of chemokines and proteins, which are involved in inflammation. 1-(Ethanesulfonyl)piperazine has been shown to cause the release of chemokines from human serum albumin and inhibit protein synthesis in gram-negative bacteria. The absorption spectra show that this compound is able to bind to albumin at the N-terminal site and S-site, which may account for its ability to inhibit protein synthesis. 1-(Ethanesulfonyl)piperazine is also able to interact with methoxy groups on s. aureus cells, preventing them from introducing themselves into human cells by binding to the surface of these cells and blocking their adhesion sites.Formula:C6H14N2O2SPurity:Min. 95%Molecular weight:178.25 g/mol



