CymitQuimica logo

CAS 62938-08-3

:

1-(bromomethyl)-3,5-di-tert-butylbenzene

Description:
1-(Bromomethyl)-3,5-di-tert-butylbenzene is an organic compound characterized by its structure, which includes a bromomethyl group attached to a benzene ring that is further substituted with two tert-butyl groups at the 3 and 5 positions. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits hydrophobic properties due to the bulky tert-butyl groups, which also contribute to its steric hindrance, influencing its reactivity and interactions with other molecules. The presence of the bromomethyl group makes it a potential electrophile, allowing for various chemical reactions, including nucleophilic substitutions. Additionally, the compound is likely to be stable under standard conditions but may undergo reactions under specific circumstances, such as exposure to strong nucleophiles or heat. Its applications may include use in organic synthesis, as an intermediate in the production of other chemical compounds, or in materials science. Safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.
Formula:C15H23Br
InChI:InChI=1/C15H23Br/c1-14(2,3)12-7-11(10-16)8-13(9-12)15(4,5)6/h7-9H,10H2,1-6H3
InChI key:SNRYBGHMHAJTTM-UHFFFAOYSA-N
SMILES:CC(C)(C)c1cc(cc(c1)C(C)(C)C)CBr
Synonyms:
  • 3,5-Di-tert-butylbenzyl Bromide
Found 5 products.