CymitQuimica logo

CAS 62939-04-2

:

3-[({4-[(4-nitrophenyl)amino]phenyl}carbamothioyl)sulfanyl]propanoic acid

Description:
3-[({4-[(4-nitrophenyl)amino]phenyl}carbamothioyl)sulfanyl]propanoic acid, with the CAS number 62939-04-2, is a chemical compound characterized by its complex structure that includes a propanoic acid moiety, a carbamothioyl group, and a nitrophenyl amino group. This compound features a thioether linkage, which contributes to its potential reactivity and biological activity. The presence of the nitro group suggests that it may exhibit electron-withdrawing properties, influencing its chemical behavior and interactions. Additionally, the amino group can participate in hydrogen bonding, enhancing solubility in polar solvents. The overall structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its unique combination of functional groups may also allow for various synthetic modifications, making it a versatile compound in research settings. However, specific properties such as solubility, melting point, and reactivity would require empirical data for detailed characterization.
Formula:C16H15N3O4S2
InChI:InChI=1/C16H15N3O4S2/c20-15(21)9-10-25-16(24)18-13-3-1-11(2-4-13)17-12-5-7-14(8-6-12)19(22)23/h1-8,17H,9-10H2,(H,18,24)(H,20,21)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Cgp 8065

    CAS:
    <p>Cgp 8065 is a filaricidal compound, a dithiocarbamate-derivative of amoscanate.</p>
    Formula:C16H15N3O4S2
    Color and Shape:Solid
    Molecular weight:377.44