CAS 6294-54-8

5-methyl-5-(pyridin-4-yl)imidazolidine-2,4-dione

Description:

5-Methyl-5-(pyridin-4-yl)imidazolidine-2,4-dione, with the CAS number 6294-54-8, is a heterocyclic organic compound characterized by its imidazolidine core structure, which features a dione functional group. This compound contains a methyl group and a pyridine ring, contributing to its unique chemical properties and potential biological activity. The presence of the pyridine moiety may enhance its solubility in polar solvents and influence its interaction with biological targets. Typically, compounds of this nature can exhibit various pharmacological activities, making them of interest in medicinal chemistry. The imidazolidine ring is known for its stability and can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the compound's structure suggests potential for hydrogen bonding and coordination with metal ions, which could be relevant in catalysis or as a ligand in coordination chemistry. Overall, 5-methyl-5-(pyridin-4-yl)imidazolidine-2,4-dione represents a versatile scaffold for further chemical exploration and application in drug development.

Formula: C₉H₉N₃O₂

InChI: InChI=1/C9H9N3O2/c1-9(6-2-4-10-5-3-6)7(13)11-8(14)12-9/h2-5H,1H3,(H2,11,12,13,14)

SMILES: CC1(c2ccncc2)C(=NC(=N1)O)O

Synonyms:

• 2,4-Imidazolidinedione, 5-Methyl-5-(4-Pyridinyl)-
• 5-Methyl-5-(pyridin-4-yl)imidazolidine-2,4-dione

5-Methyl-5-pyridin-4-yl-imidazolidine-2,4-dione

CAS: 6294-54-8

Formula: C₉H₉N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.1867

Ref: IN-DA00EITT

5-Methyl-5-(pyridin-4-yl)imidazolidine-2,4-dione

CAS: 6294-54-8

5-Methyl-5-(pyridin-4-yl)imidazolidine-2,4-dione is a compound that is structurally related to cisplatin. It has antibacterial activity and has been found to inhibit the growth of Escherichia coli. 5-Methyl-5-(pyridin-4-yl)imidazolidine-2,4-dione has been shown to be effective against gram positive bacteria such as Staphylococcus aureus and Streptococcus pneumoniae, but not against gram negative bacteria such as Pseudomonas aeruginosa. The molecule is an inhibitor with a broad spectrum of action. It binds to the active site of bacterial DNA gyrase, which is an enzyme that maintains the integrity of bacterial DNA by preventing supercoiling. This binding prevents the formation of an antibiotic resistant complex with the enzyme cell wall synthesis that is required for cell wall biosynthesis

Formula: C₉H₉N₃O₂

Purity: Min. 95%

Molecular weight: 191.19 g/mol

Ref: 3D-GAA29454