CAS 6294-79-7
:Diallyl isocyanurate
Description:
Diallyl isocyanurate (CAS 6294-79-7) is an organic compound characterized by its structure, which features multiple allyl groups attached to an isocyanurate core. It is a white to off-white crystalline solid that is soluble in organic solvents but generally insoluble in water. This compound is known for its thermal stability and ability to act as a crosslinking agent in various polymer systems, particularly in the production of thermosetting resins. Diallyl isocyanurate exhibits good resistance to heat and chemicals, making it suitable for applications in coatings, adhesives, and composites. Additionally, it can enhance the mechanical properties of materials when used as a modifier. The compound is also recognized for its potential use in the synthesis of other chemical derivatives and in the field of polymer chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C9H11N3O3
InChI:InChI=1S/C9H11N3O3/c1-3-5-11-7(13)10-8(14)12(6-4-2)9(11)15/h3-4H,1-2,5-6H2,(H,10,13,14)
InChI key:InChIKey=UCBVELLBUAKUNE-UHFFFAOYSA-N
SMILES:C(C=C)N1C(=O)N(CC=C)C(=O)NC1=O
Synonyms:- 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-di-2-propenyl-
- 1,3,5-triazine-2,4,6(1H,3H,5H)-trione, 1,3-di-2-propen-1-yl-
- 1,3-Bis(prop-2-en-1-yl)-1,3,5-triazinane-2,4,6-trione
- 1,3-Bis(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione
- 1,3-Di-2-propen-1-yl-1,3,5-triazine-2,4,6(1H,3H,5H)-trione
- 1,3-Diallyl-1,3,5-triazinane-2,4,6-trione
- 1,3-Diallylisocyanurate
- 1,3-Diallylisocyanuric acid
- Da-Ic
- Da-Ica
- Diallyl isocyanurate
- NSC 11691
- s-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-diallyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Diallyl Isocyanurate
CAS:Formula:C9H11N3O3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:209.211,3-Diallyl-1,3,5-triazinane-2,4,6-trione
CAS:Formula:C9H11N3O3Purity:97%Color and Shape:SolidMolecular weight:209.20191,3-Diallyl-1,3,5-Triazinane-2,4,6-Trione
CAS:1,3-Diallyl-1,3,5-Triazinane-2,4,6-TrionePurity:98%Molecular weight:209.20g/mol1,3-Diallyl-1,3,5-triazinane-2,4,6-trione
CAS:Formula:C9H11N3O3Purity:95%Color and Shape:SolidMolecular weight:209.205Diallyl Isocyanurate
CAS:Diallyl Isocyanurate is an aliphatic hydrocarbon and a cross-linking agent. It reacts with amines to form amides, which are the backbone of many polymers and plastics. This chemical has strong hydrogen bonding properties, making it suitable for use as a sealant. Diallyl Isocyanurate also has hydroxyl groups that can react with other compounds to form adducts or polyclonal antibodies. It is chemically stable and has a high boiling point, making it useful in radiation as a sealant.
Formula:C9H11N3O3Purity:Min. 95%Molecular weight:209.21 g/mol




