CAS 6295-35-8: 6-methoxy-4-methyl-2H-chromen-2-one

Description:6-Methoxy-4-methyl-2H-chromen-2-one, also known as 6-methoxyflavone, is a synthetic flavonoid compound characterized by its chromenone structure. It features a methoxy group at the 6-position and a methyl group at the 4-position of the chromenone ring. This compound is typically a yellow crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and dimethyl sulfoxide, while being less soluble in water. Its molecular structure contributes to its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties, which have been the subject of various studies. The presence of the methoxy group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, 6-methoxy-4-methyl-2H-chromen-2-one can participate in various chemical reactions typical of flavonoids, such as oxidation and conjugation, making it a valuable compound in both research and potential therapeutic applications. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula:C₁₁H₁₀O₃

InChI:InChI=1/C11H10O3/c1-7-5-11(12)14-10-4-3-8(13-2)6-9(7)10/h3-6H,1-2H3

Synonyms:
2H-1-Benzopyran-2-one, 6-methoxy-4-methyl-
6-Methoxy-4-methyl-2H-chromen-2-on
6-Méthoxy-4-méthyl-2H-chromén-2-one
6-Methoxy-4-methyl-2H-chromen-2-one

Found 6 products.

Product data	Purity	Price range	Estimated delivery
6-Methoxy-4-methylcoumarin REF: 3B-M1398CAS: 6295-35-8	>98.0%(GC)	69.00 €~203.00 €	Fri 25 Apr 25
6-Methoxy-4-methyl-2H-chromen-2-one REF: IN-DA003N9NCAS: 6295-35-8	98%	40.00 €~326.00 €	Fri 02 May 25
4-Methyl-6-Methoxycoumarin REF: 54-BUP14118CAS: 6295-35-8	≥95%	58.00 €~321.00 €	Mon 05 May 25
4-Methyl-6-Methoxycoumarin REF: TM-T8113CAS: 6295-35-8	96.9%	35.00 €~160.00 €	Fri 09 May 25
6-Methoxy-4-methyl-2H-chromen-2-one REF: 10-F720624CAS: 6295-35-8	98%	To inquire	Mon 12 May 25
6-Methoxy-4-methylcoumarin REF: 3D-GAA29535CAS: 6295-35-8	Min. 95%	- - -	Discontinued product