CAS 6295-87-0
:Pyridinium, 1-amino-, iodide (1:1)
Description:
Pyridinium, 1-amino-, iodide (1:1), with the CAS number 6295-87-0, is an organic compound characterized by its pyridinium structure, which includes a nitrogen atom in a six-membered aromatic ring. This compound features an amino group (-NH2) attached to the pyridine ring, contributing to its basicity and potential reactivity. The iodide component indicates that it forms a salt with iodine, which can influence its solubility and stability in various solvents. Pyridinium salts are generally known for their ability to act as ionic compounds, exhibiting good solubility in polar solvents like water. The presence of the amino group can also impart biological activity, making such compounds of interest in medicinal chemistry. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the reactivity of the amino group. Overall, Pyridinium, 1-amino-, iodide (1:1) is a versatile compound with applications in organic synthesis and potential uses in pharmaceuticals.
Formula:C5H7N2·I
InChI:InChI=1S/C5H7N2.HI/c6-7-4-2-1-3-5-7;/h1-5H,6H2;1H/q+1;/p-1
InChI key:InChIKey=NDRLPYIMWROJBG-UHFFFAOYSA-M
SMILES:N[N+]=1C=CC=CC1.[I-]
Synonyms:- 1-Aminopyridin-1-ium iodide
- 1-Aminopyridinium
- N-Aminopyridinium iodide
- NSC 49542
- Pyridinium, 1-amino-, iodide
- Pyridinium, 1-amino-, iodide (1:1)
- Pyridinium-1-Ylazanide
- 1-Aminopyridinium iodide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-Aminopyridinium iodide, 97%
CAS:1-Aminopyridinium iodide is a reagent used as a building block to construct fused heterocycles, synthesis of substituted pyridines, dipolar cycloadditions, ylide type reactions. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentationFormula:C5H7IN2Purity:97%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:222.031-Aminopyridin-1-ium iodide
CAS:Formula:C5H7IN2Purity:96%Color and Shape:SolidMolecular weight:222.02691-Aminopyridinium iodide
CAS:Formula:C5H7IN2Purity:≥ 98.0%Color and Shape:Off white to beige solidMolecular weight:222.031-Aminopyridinium iodide
CAS:1-Aminopyridinium iodideFormula:C5H7N2·IPurity:98%Color and Shape: brown solidMolecular weight:222.02695g/mol1-Aminopyridinium Iodide
CAS:Formula:C5H7IN2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:222.031-Aminopyridinium iodide
CAS:1-Aminopyridinium iodide is a reactive compound that can bind to receptors, including the epidermal growth factor receptor. It is also a pyridinium salt and a type of chlorine. The compound has been shown to be effective in inhibiting cancer cell growth and has been used in chemotherapy treatments. 1-Aminopyridinium iodide binds to the glycogen synthase kinase 3 enzyme, which regulates cellular processes such as cell division, and inhibits its activity. This causes the process of glycogen synthesis to stop and leads to cell death by apoptosis. 1-Aminopyridinium iodide is most commonly used in cancer research because of its ability to inhibit tumor growth.
Formula:C5H7IN2Purity:Min. 95%Color and Shape:PowderMolecular weight:222.03 g/mol1-Aminopyridin-1-ium iodide
CAS:Formula:C5H7IN2Purity:95%Color and Shape:Powder or Crystalline Powder or Solid or ChunksMolecular weight:222.029






