CAS 62953-73-5

1-(carboxymethyl)cyclopentanecarboxylic acid

Description:

1-(Carboxymethyl)cyclopentanecarboxylic acid, with the CAS number 62953-73-5, is an organic compound characterized by its cyclopentane ring structure substituted with two carboxylic acid groups. This compound features a carboxymethyl group (-CH2COOH) attached to one of the carbon atoms in the cyclopentane ring, along with an additional carboxylic acid group on another carbon. The presence of these functional groups imparts acidic properties to the molecule, making it soluble in water and capable of participating in various chemical reactions, such as esterification and neutralization. The compound may exhibit chelating properties due to the carboxylic acid groups, potentially interacting with metal ions. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a biochemical reagent. Additionally, the compound's ability to form hydrogen bonds can influence its physical properties, such as melting and boiling points, as well as its reactivity in different chemical environments.

Formula: C₈H₁₂O₄

InChI: InChI=1/C8H12O4/c9-6(10)5-8(7(11)12)3-1-2-4-8/h1-5H2,(H,9,10)(H,11,12)

SMILES: C1CCC(C1)(CC(=O)O)C(=O)O

Synonyms:

• 1-(Carboxymethyl)Cyclopentane-1-Carboxylic Acid

1-(Carboxymethyl)cyclopentane-1-carboxylic acid

CAS: 62953-73-5

1-(Carboxymethyl)cyclopentane-1-carboxylic acid

Formula: C₈H₁₂O₄

Purity: ≥95%

Color and Shape: crystalline powder

Molecular weight: 172.18g/mol

Ref: 54-OR110660

1-(carboxymethyl)cyclopentanecarboxylic acid

CAS: 62953-73-5

Purity: 95.0%

Molecular weight: 172.17999267578125

Ref: 10-F518674

1-(Carboxymethyl)cyclopentanecarboxylic acid

CAS: 62953-73-5

1-Carboxymethylcyclopentane-1,1-dicarboxylic acid is a crosslinker that can be used for the production of polymers. It is biodegradable and can be hydrolyzed under alkaline conditions. 1-Carboxymethylcyclopentane-1,1-dicarboxylic acid reacts with an alkynyl group to form a polycarboxylic acid. This reaction product may be a monocarboxylic or dicarboxylic acid. 1-Carboxymethylcyclopentane-1,1-dicarboxylic acid has been used as a viscosity enhancer and crosslinking agent for various polymers. This compound is also an effective polymerization initiator for the production of silicone elastomers.

Formula: C₈H₁₂O₄

Purity: Min. 95%

Molecular weight: 172.18 g/mol

Ref: 3D-MCA95373