CAS 62953-74-6

Ethyl α,1-dicyanocyclopentaneacetate

Description:

Ethyl α,1-dicyanocyclopentaneacetate, identified by its CAS number 62953-74-6, is an organic compound characterized by its unique structure that includes a cyclopentane ring substituted with two cyano groups and an ethyl ester functional group. This compound typically exhibits properties common to esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of cyano groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. Ethyl α,1-dicyanocyclopentaneacetate may also display interesting biological activities, although specific biological data may vary. Its synthesis often involves multi-step organic reactions, highlighting its utility in synthetic organic chemistry. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Overall, this compound serves as a valuable building block in the development of more complex chemical entities.

Formula: C₁₁H₁₄N₂O₂

InChI: InChI=1S/C11H14N2O2/c1-2-15-10(14)9(7-12)11(8-13)5-3-4-6-11/h9H,2-6H2,1H3

InChI key: InChIKey=OBABJTYJPFDGJW-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(C#N)C1(C#N)CCCC1

Synonyms:

• Cyclopentaneacetic acid, α,1-dicyano-, ethyl ester
• Ethyl α,1-dicyanocyclopentaneacetate

Ethyl 2-cyano-2-(1-cyanocyclopentyl)acetate

CAS: 62953-74-6

Versatile small molecule scaffold

Formula: C₁₁H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 206.24 g/mol

Ref: 3D-MCA95374