CymitQuimica logo

CAS 62956-62-1

:

6-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid

Description:
6-Methoxy-2,3-dihydro-1H-indene-1-carboxylic acid, with the CAS number 62956-62-1, is an organic compound characterized by its indene structure, which features a fused cyclopentene and benzene ring. This compound contains a methoxy group (-OCH3) at the 6-position and a carboxylic acid group (-COOH) at the 1-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The dihydro form indicates that the compound has two hydrogen atoms added to the indene structure, which can affect its stability and reactivity. As a carboxylic acid, it can participate in various chemical reactions, including esterification and acid-base reactions. The compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Overall, its unique structure and functional groups provide a foundation for diverse chemical behavior and potential applications in various fields.
Formula:C11H12O3
InChI:InChI=1/C11H12O3/c1-14-8-4-2-7-3-5-9(11(12)13)10(7)6-8/h2,4,6,9H,3,5H2,1H3,(H,12,13)
InChI key:NYAXSJZIUOHLMW-UHFFFAOYSA-N
SMILES:COc1ccc2CCC(c2c1)C(=O)O
Found 6 products.