CAS 6296-53-3
:N-(1,3-Dioxo-1,3-dihydro-2-benzofuran-4-yl)acetamide
Description:
N-(1,3-Dioxo-1,3-dihydro-2-benzofuran-4-yl)acetamide, with the CAS number 6296-53-3, is a chemical compound that features a benzofuran core structure, which is characterized by a fused benzene and furan ring. This compound contains an acetamide functional group, contributing to its potential reactivity and biological activity. The presence of the 1,3-dioxo moiety indicates that it may exhibit keto-enol tautomerism, which can influence its chemical behavior and interactions. Typically, compounds like this may be investigated for their pharmacological properties, as the benzofuran structure is often associated with various biological activities, including anti-inflammatory and analgesic effects. The compound's solubility, stability, and reactivity can vary based on the specific conditions, such as pH and solvent, making it important for researchers to consider these factors in experimental designs. Overall, N-(1,3-Dioxo-1,3-dihydro-2-benzofuran-4-yl)acetamide represents a class of organic compounds with potential applications in medicinal chemistry and material science.
Formula:C10H7NO4
InChI:InChI=1/C10H7NO4/c1-5(12)11-7-4-2-3-6-8(7)10(14)15-9(6)13/h2-4H,1H3,(H,11,12)
SMILES:CC(=Nc1cccc2c1C(=O)OC2=O)O
Synonyms:- acetamide, N-(1,3-dihydro-1,3-dioxo-4-isobenzofuranyl)-
- 3-Acetamidophthalic anhydride
- 1,3-Dioxo-2-isoindolineacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1,3-Dioxo-2-isoindolineaceticacid
CAS:Formula:C10H7NO4Purity:98%Color and Shape:SolidMolecular weight:205.16693-Acetamidophthalic anhydride
CAS:3-Acetamidophthalic anhydridePurity:98%Molecular weight:205.17g/mol3-Acetamidophthalic Anhydride
CAS:Formula:C10H7NO4Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:205.173-Acetamidophthalic anhydride
CAS:3-Acetamidophthalic anhydride is a potent, selective and efficient reagent for the synthesis of 3-substituted amines. This compound is prepared by reacting an acetamide with phthalic anhydride in the presence of an alkali metal hydroxide. The reaction yields are in excess of 99%. The chemical transformation can be carried out on either aliphatic or aromatic amines. 3-Acetamidophthalic anhydride has been used to synthesize apremilast, a drug that has potent activity against TNF-α.Formula:C10H7NO4Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:205.17 g/molN-(1,3-Dioxo-1,3-dihydroisobenzofuran-4-yl)acetamide
CAS:Formula:C10H7NO4Purity:95%Color and Shape:SolidMolecular weight:205.169






