CAS 629644-64-0: 4-Chloro-8-(difluoromethoxy)quinoline
Description:4-Chloro-8-(difluoromethoxy)quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a chlorine atom at the 4-position and a difluoromethoxy group at the 8-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen substituents that can influence biological activity. The difluoromethoxy group may enhance lipophilicity and metabolic stability, making it a candidate for further investigation in drug design. Additionally, the compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine and fluorine atoms, which may affect its interaction with biological targets. As with many quinoline derivatives, it may also exhibit antimicrobial or antimalarial properties, warranting further research into its potential therapeutic applications.
Formula:C10H6ClF2NO
InChI:InChI=1S/C10H6ClF2NO/c11-7-4-5-14-9-6(7)2-1-3-8(9)15-10(12)13/h1-5,10H
InChI key:InChIKey=SOJILQASVKSFHJ-UHFFFAOYSA-N
SMILES:FC(F)OC1=CC=CC2=C(Cl)C=CN=C12
- Synonyms:
- Quinoline, 4-chloro-8-(difluoromethoxy)-
- 4-Chloro-8-(difluoromethoxy)quinoline
- 8-(Difluoromethoxy)-4-chloroquinoline
