CAS 629652-73-9

2-Amino-6-chloro-3-hydroxybenzoic acid

Description:

2-Amino-6-chloro-3-hydroxybenzoic acid, with the CAS number 629652-73-9, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group, a hydroxyl group, and a chlorine atom. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the hydroxyl and amino groups. The amino group contributes to its basicity, while the carboxylic acid group can act as an acid, allowing for potential zwitterionic behavior in solution. The chlorine substituent can influence the compound's reactivity and stability, as well as its interaction with biological systems. This compound may be of interest in pharmaceutical research and development due to its potential biological activity, particularly in the context of drug design and synthesis. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values.

Formula: C₇H₆ClNO₃

InChI: InChI=1S/C7H6ClNO3/c8-3-1-2-4(10)6(9)5(3)7(11)12/h1-2,10H,9H2,(H,11,12)

InChI key: InChIKey=ZEGFVPKZTPJGRV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N)C(O)=CC=C1Cl

Synonyms:

• 2-Amino-6-chloro-3-hydroxybenzoic acid
• Benzoic acid, 2-amino-6-chloro-3-hydroxy-

2-amino-6-chloro-3-hydroxybenzoic acid

Controlled Product

CAS: 629652-73-9

Applications 2-amino-6-chloro-3-hydroxybenzoic acid (cas# 629652-73-9) is a useful research chemical.

Formula: C₇H₆NO₃Cl

Color and Shape: Neat

Molecular weight: 187.58

Ref: TR-A605578

2-Amino-6-chloro-3-hydroxybenzoic acid

CAS: 629652-73-9

Versatile small molecule scaffold

Formula: C₇H₆ClNO₃

Purity: Min. 95%

Molecular weight: 187.58 g/mol

Ref: 3D-EAB65273