CAS 629655-23-8

2-Chloro-3-nitropyridin-4-ol

Description:

2-Chloro-3-nitropyridin-4-ol is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a chlorine atom, a nitro group, and a hydroxyl group. The chlorine atom is located at the 2-position, the nitro group at the 3-position, and the hydroxyl group at the 4-position of the pyridine ring. This compound is typically a solid at room temperature and exhibits properties such as solubility in polar solvents due to the presence of the hydroxyl group. It may display biological activity, making it of interest in medicinal chemistry and agrochemical applications. The nitro group can contribute to its reactivity, potentially participating in electrophilic substitution reactions. Additionally, the presence of both electron-withdrawing (nitro and chloro) and electron-donating (hydroxyl) groups can influence its chemical behavior and interactions with other molecules. Safety data should be consulted, as compounds with halogen and nitro substituents can pose health and environmental risks.

Formula: C₅H₃ClN₂O₃

InChI: InChI=1/C5H3ClN2O3/c6-5-4(8(10)11)3(9)1-2-7-5/h1-2H,(H,7,9)

SMILES: c1cnc(c(c1O)N(=O)=O)Cl

2-Chloro-3-nitropyridin-4-ol

CAS: 629655-23-8

Formula: C₅H₃ClN₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 174.5419

Ref: IN-DA00ED3T

2-Chloro-3-nitropyridin-4-ol

CAS: 629655-23-8

2-Chloro-3-nitropyridin-4-ol

Purity: 98%

Molecular weight: 174.54g/mol

Ref: 54-OR933369

2-Chloro-3-nitropyridin-4-ol

CAS: 629655-23-8

Formula: C₅H₃ClN₂O₃

Purity: 96%

Color and Shape: Solid, Yellow powder

Molecular weight: 173.983

Ref: 10-F209656