CymitQuimica logo

CAS 6297-67-2

:

methyl 2-methyl-3-[(2-phenylethyl)amino]propanoate

Description:
Methyl 2-methyl-3-[(2-phenylethyl)amino]propanoate, with the CAS number 6297-67-2, is an organic compound characterized by its ester functional group, which is typical of methyl esters. This compound features a branched alkyl chain and an amino group, contributing to its potential biological activity. The presence of the phenylethyl group suggests that it may exhibit aromatic properties, which can influence its solubility and reactivity. Generally, compounds of this nature can be involved in various chemical reactions, including esterification and amine interactions. The molecular structure indicates that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both ester and amine functionalities. Additionally, the compound's characteristics, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, methyl 2-methyl-3-[(2-phenylethyl)amino]propanoate is a complex molecule with potential applications in various fields, including organic synthesis and drug development.
Formula:C13H19NO2
InChI:InChI=1/C13H19NO2/c1-11(13(15)16-2)10-14-9-8-12-6-4-3-5-7-12/h3-7,11,14H,8-10H2,1-2H3
InChI key:KKHGLVXWFXAALZ-UHFFFAOYSA-N
SMILES:CC(CNCCc1ccccc1)C(=O)OC
Synonyms:
  • Propanoic Acid, 2-Methyl-3-[(2-Phenylethyl)Amino]-, Methyl Ester
Found 0 products.