CAS 6298-46-0
:N-[2-(3,4-Diethoxyphenyl)ethyl]-3,4-diethoxybenzeneacetamide
Description:
N-[2-(3,4-Diethoxyphenyl)ethyl]-3,4-diethoxybenzeneacetamide, with the CAS number 6298-46-0, is a chemical compound characterized by its complex structure, which includes multiple ethoxy groups and an acetamide functional group. This compound is likely to exhibit properties typical of organic amides, such as moderate solubility in organic solvents and potential bioactivity due to its aromatic and aliphatic components. The presence of diethoxyphenyl groups suggests that it may have interesting electronic properties, possibly influencing its reactivity and interactions with biological systems. Additionally, the compound's structure may allow for various substitution reactions, making it a candidate for further chemical modifications. Its potential applications could span across pharmaceuticals, where such compounds are often explored for therapeutic effects, particularly in areas related to pain management or anti-inflammatory activities. However, specific biological activity, toxicity, and stability would require further empirical investigation to fully understand its characteristics and potential uses.
Formula:C24H33NO5
InChI:InChI=1S/C24H33NO5/c1-5-27-20-11-9-18(15-22(20)29-7-3)13-14-25-24(26)17-19-10-12-21(28-6-2)23(16-19)30-8-4/h9-12,15-16H,5-8,13-14,17H2,1-4H3,(H,25,26)
InChI key:InChIKey=WXWBNUBJVJKZAS-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OCC)C=CC(CC(NCCC2=CC(OCC)=C(OCC)C=C2)=O)=C1
Synonyms:- 2-(3,4-diethoxyphenyl)-N-[2-(3,4-diethoxyphenyl)ethyl]acetamide
- Acetamide, N-(3,4-diethoxyphenethyl)-2-(3,4-diethoxyphenyl)-
- Benzeneacetamide, N-[2-(3,4-diethoxyphenyl)ethyl]-3,4-diethoxy-
- N-[2-(3,4-Diethoxyphenyl)ethyl]-3,4-diethoxybenzeneacetamide
- NSC 41825
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N-(3,4-Diethoxyphenethyl)ethyl]-2-(3,4-diethoxyphenyl)acetamide
CAS:Controlled ProductFormula:C24H33NO5Color and Shape:NeatMolecular weight:415.522


