CAS 6298-77-7
:propan-2-yl morpholine-4-carboxylate
Description:
Propan-2-yl morpholine-4-carboxylate, also known by its CAS number 6298-77-7, is an organic compound characterized by its morpholine ring structure, which is a six-membered heterocycle containing one nitrogen atom. This compound features a propan-2-yl group, indicating the presence of an isopropyl moiety, and a carboxylate functional group, which contributes to its chemical reactivity and solubility properties. Typically, morpholine derivatives exhibit moderate polarity, making them soluble in polar solvents like water and alcohols. The presence of the carboxylate group suggests potential for hydrogen bonding and interaction with various biological systems, which may influence its pharmacological properties. Additionally, propan-2-yl morpholine-4-carboxylate may be utilized in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Its safety profile and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings.
Formula:C8H15NO3
InChI:InChI=1/C8H15NO3/c1-7(2)12-8(10)9-3-5-11-6-4-9/h7H,3-6H2,1-2H3
SMILES:CC(C)OC(=O)N1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Morpholinecarboxylic Acid Isopropyl Ester
CAS:Controlled ProductFormula:C8H15NO3Color and Shape:NeatMolecular weight:173.21
