CAS 6298-90-4
:ethane-1,2-diyl bis(hexadecylcarbamate)
Description:
Ethane-1,2-diyl bis(hexadecylcarbamate), with the CAS number 6298-90-4, is a chemical compound characterized by its long-chain fatty acid derivatives. This substance features a central ethane-1,2-diol backbone, which is substituted with two hexadecylcarbamate groups. The hexadecyl chains contribute to its hydrophobic properties, making it a surfactant and potentially useful in various applications, including emulsification and stabilization in formulations. The carbamate functional groups provide reactivity and can participate in further chemical modifications. Ethane-1,2-diyl bis(hexadecylcarbamate) is typically a solid or semi-solid at room temperature, exhibiting low solubility in water due to its long hydrophobic chains, but it may dissolve in organic solvents. Its unique structure allows it to interact with both polar and non-polar environments, making it valuable in the development of materials such as coatings, adhesives, and drug delivery systems. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C36H72N2O4
InChI:InChI=1/C36H72N2O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-37-35(39)41-33-34-42-36(40)38-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-34H2,1-2H3,(H,37,39)(H,38,40)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
