CAS 62981-82-2

2-amino-6-methyl-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one

Description:

2-amino-6-methyl-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one, with the CAS number 62981-82-2, is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both pyrrole and pyrimidine rings. This compound features an amino group and a methyl group, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may interact with biological targets such as enzymes or receptors. Its structural features suggest that it could participate in hydrogen bonding and other intermolecular interactions, influencing its pharmacokinetic properties. Additionally, the presence of the dihydro moiety indicates that it may undergo further chemical transformations, making it a versatile candidate for synthetic modifications. Overall, this compound's unique structure and functional groups position it as a subject of interest in various chemical and pharmaceutical research fields.

Formula: C₇H₈N₄O

InChI: InChI=1/C7H8N4O/c1-3-2-4-5(9-3)10-7(8)11-6(4)12/h2H,1H3,(H4,8,9,10,11,12)

SMILES: Cc1cc2c([nH]1)[nH]c(=N)nc2O

Synonyms:

• 2-Amino-6-methyl-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one
• 2-amino-6-methyl-3H-pyrrolo[2,3-d]pyrimidin-4-ol
• 3H-pyrrolo[2,3-d]pyrimidin-4-ol, 2-amino-6-methyl-
• 4H-pyrrolo[2,3-d]pyrimidin-4-one, 2-amino-3,7-dihydro-6-methyl-

2-AMINO-5-METHYL-3,7-DIHYDRO-4H-PYRROLO[2,3-D]PYRIMIDIN-4-ONE

CAS: 62981-82-2

Formula: C₇H₈N₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.1646

Ref: IN-DA00EFRH

2-AMINO-6-METHYL-7H-PYRROLO[2,3-D]PYRIMIDIN-4-OL

CAS: 62981-82-2

Formula: C₇H₈N₄O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 164.168

Ref: 10-F538328