CAS 62983-70-4
:di-beta-D-xylopyranosylamine
Description:
Di-beta-D-xylopyranosylamine, with the CAS number 62983-70-4, is a glycosylamine derivative characterized by the presence of two beta-D-xylopyranosyl groups attached to an amine. This compound features a pyranose ring structure, which is a six-membered ring containing five carbon atoms and one oxygen atom, typical of many sugars. The beta configuration indicates that the hydroxyl group on the anomeric carbon is oriented upwards in the Haworth projection. Di-beta-D-xylopyranosylamine is soluble in water due to its polar nature, attributed to the hydroxyl groups on the sugar moieties. It may exhibit biological activity, potentially interacting with various biological systems, given its structural similarity to other glycosylamines that are known to play roles in cellular processes. The compound's properties, such as stability, reactivity, and potential applications, can be influenced by the presence of the amine group, which may participate in further chemical reactions or serve as a functional group in biological contexts.
Formula:C10H19NO8
InChI:InChI=1/C10H19NO8/c12-3-1-18-9(7(16)5(3)14)11-10-8(17)6(15)4(13)2-19-10/h3-17H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-/m1/s1
Synonyms:- Di(beta-D-xylopyranosyl)amine
- (2R,3R,4S,5R)-2-[[(2R,3R,4S,5R)-3,4,5-trihydroxytetrahydropyran-2-yl]amino]tetrahydropyran-3,4,5-triol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(2R,2'R,3R,3'R,4S,4'S,5R,5'R)-2,2'-Azanediylbis(tetrahydro-2H-pyran-3,4,5-triol)
CAS:Formula:C10H19NO8Color and Shape:SolidMolecular weight:281.2598

