CAS 62984-53-6

2-[(cyclohexylamino)methyl]phenol

Description:

2-[(Cyclohexylamino)methyl]phenol, with the CAS number 62984-53-6, is an organic compound characterized by the presence of a phenolic group and a cyclohexylamino side chain. This compound typically appears as a solid or viscous liquid, depending on its purity and temperature. It features a hydroxyl (-OH) group attached to a benzene ring, which contributes to its potential as a phenolic compound with various applications in chemical synthesis and material science. The cyclohexylamino group enhances its solubility in organic solvents and may influence its biological activity, making it of interest in medicinal chemistry. The compound's structure suggests it may exhibit properties such as antioxidant activity or serve as a precursor in the synthesis of more complex molecules. Additionally, its stability and reactivity can be influenced by the presence of the amino group, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. Overall, 2-[(cyclohexylamino)methyl]phenol is a versatile compound with potential applications in various fields.

Formula: C₁₃H₁₉NO

InChI: InChI=1/C13H19NO/c15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12/h4-6,9,12,14-15H,1-3,7-8,10H2

SMILES: C1CCC(CC1)NCc1ccccc1O

Synonyms:

• 2-Cyclohexylaminomethyl-phenol

2-[(Cyclohexylamino)methyl]phenol

CAS: 62984-53-6

Versatile small molecule scaffold

Formula: C₁₃H₁₉NO

Purity: Min. 95%

Molecular weight: 205.3 g/mol

Ref: 3D-MCA98453