CAS 6299-92-9
:1H-benzimidazol-1-amine
Description:
1H-benzimidazol-1-amine, with the CAS number 6299-92-9, is an organic compound characterized by its bicyclic structure, which consists of a benzimidazole ring fused with an amine group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the amino group that can engage in hydrogen bonding. It exhibits basic properties due to the nitrogen atoms in the benzimidazole ring and the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. 1H-benzimidazol-1-amine is of interest in medicinal chemistry and material science, often studied for its potential biological activities, including antimicrobial and anticancer properties. Its derivatives may also serve as ligands in coordination chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C7H7N3
InChI:InChI=1/C7H7N3/c8-10-5-9-6-3-1-2-4-7(6)10/h1-5H,8H2
SMILES:c1ccc2c(c1)ncn2N
Synonyms:- Aminobenzimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-BENZIMIDAZOL-1-AMINE(9CI)
CAS:Formula:C7H7N3Purity:97%Color and Shape:SolidMolecular weight:133.15061H-Benzimidazol-1-amine
CAS:1H-Benzimidazol-1-amine is a chemical compound that is found in the alkaloid family. It has been shown to have a number of different polymorphic forms and can be found as an anion, protonated form or as a neutral molecule. 1H-Benzimidazol-1-amine has been shown to be an intermediate in the synthesis of piperazine and morpholine. 1H-Benzimidazol-1-amine is also used as an intermediate for the production of picrate, pyrrole, and chloride.Formula:C7H7N3Purity:Min. 95%Molecular weight:133.15 g/mol
