CAS 63-64-9

(3,4-dimethoxyphenyl)-N-methylmethanaminium

Description:

The chemical substance known as "(3,4-dimethoxyphenyl)-N-methylmethanaminium" with the CAS number 63-64-9 is commonly referred to as methoxyphenamine. It is an organic compound characterized by the presence of a dimethoxy-substituted phenyl group and a quaternary ammonium structure. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents. Its molecular structure contributes to its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. Methoxyphenamine is known for its stimulant properties and has been investigated for its effects on the central nervous system. As with many chemical substances, it is essential to handle it with care, adhering to safety protocols due to its pharmacological effects and potential toxicity. The compound's stability, reactivity, and interactions with other substances can vary based on environmental conditions and the presence of other chemicals.

Formula: C₁₀H₁₆NO₂

InChI: InChI=1/C10H15NO2/c1-11-7-8-4-5-9(12-2)10(6-8)13-3/h4-6,11H,7H2,1-3H3/p+1

Synonyms:

• N-Methyl-3,4-dimethoxybenzylamine
• 1-(3,4-dimethoxyphenyl)-N-methylmethanamine
• Benzenemethanamine, 3,4-dimethoxy-N-methyl-
• (3,4-Dimethoxybenzyl)Methylamine

(3,4-Dimethoxybenzyl)Methylamine

CAS: 63-64-9

Formula: C₁₀H₁₅NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 181.2316

Ref: IN-DA003T6L

(3,4-Dimethoxybenzyl)methylamine

CAS: 63-64-9

(3,4-Dimethoxybenzyl)methylamine

Purity: 99%

Molecular weight: 181.23g/mol

Ref: 54-OR912588

(3,4-Dimethoxybenzyl)methylamine

CAS: 63-64-9

Formula: C₁₀H₁₅NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 181.235

Ref: 10-F042010