CAS 6300-44-3
:(3E)-3-({4-[(E)-(2,4-diamino-5-methylphenyl)diazenyl]phenyl}hydrazono)-6-oxocyclohexa-1,4-diene-1-carboxylic acid
Description:
The chemical substance known as (3E)-3-({4-[(E)-(2,4-diamino-5-methylphenyl)diazenyl]phenyl}hydrazono)-6-oxocyclohexa-1,4-diene-1-carboxylic acid, with the CAS number 6300-44-3, is a complex organic compound characterized by its azo and hydrazone functional groups. This compound features a cyclohexadiene core, which contributes to its potential reactivity and stability. The presence of amino groups suggests that it may exhibit basic properties and could participate in various chemical reactions, including those typical of amines and azo compounds. The structure indicates potential applications in dye chemistry, pharmaceuticals, or as a biological probe due to its ability to form complexes with metal ions or interact with biological macromolecules. Additionally, the presence of a carboxylic acid group implies that it can engage in acid-base reactions, influencing its solubility and reactivity in different environments. Overall, this compound's unique structural features make it a subject of interest in both synthetic and applied chemistry.
Formula:C20H18N6O3
InChI:InChI=1/C20H18N6O3/c1-11-8-18(17(22)10-16(11)21)26-24-13-4-2-12(3-5-13)23-25-14-6-7-19(27)15(9-14)20(28)29/h2-10,23H,21-22H2,1H3,(H,28,29)/b25-14+,26-24+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
NSC45586
CAS:NSC45586 is a protein phosphatase PHLPP inhibitor, which is selective for PHLPP1 and PHLPP2.
Formula:C20H18N6NaO3Purity:99.31%Color and Shape:SolidMolecular weight:413.4NSC 45586
CAS:NSC 45586 is an inhibitor of collagenase, which is one of the enzymes that breaks down collagen. It has been shown to have a pharmacodynamic effect on the tibia in rats, and it also has a pharmacokinetic profile similar to other inhibitors of this enzyme. NSC 45586 has a homology domain with proteinases that have been shown to have therapeutic potential for osteoarthritis and rheumatoid arthritis. The drug inhibits the activity of key enzymes involved in cartilage degradation, such as collagenase, proteoglycanase and aggrecanase. It also inhibits phosphatases, which are enzymes that remove phosphate groups from proteins. NSC 45586 can be used intra-articularly or systemically for treatment of osteoarthritic joints by preventing the breakdown of collagen and cartilage.Formula:C20H18N6NaO3Purity:Min. 95%Molecular weight:413.4 g/mol


