CAS 6301-31-1

1-cyclohexyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile

Description:

1-Cyclohexyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile, with the CAS number 6301-31-1, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which features two carbonyl (dioxo) groups and a cyano (carbonitrile) functional group. This compound typically exhibits a solid state at room temperature and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the cyclohexyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The dioxo and cyano functionalities can participate in various chemical reactions, including nucleophilic additions and cycloadditions, which may be exploited in synthetic organic chemistry. Additionally, the compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of anti-cancer or anti-inflammatory agents. However, specific reactivity and stability can vary based on environmental conditions and the presence of other reagents.

Formula: C₁₁H₁₃N₃O₂

InChI: InChI=1/C11H13N3O2/c12-6-8-7-14(11(16)13-10(8)15)9-4-2-1-3-5-9/h7,9H,1-5H2,(H,13,15,16)

SMILES: C1CCC(CC1)n1cc(C#N)c(nc1=O)O

Synonyms:

• 1-Cyclohexyl-1,2,3,4-tetrahydro-2,4-dioxopyrimidine-5-carbonitrile
• 1-cyclohexyl-2,4-dioxopyrimidine-5-carbonitrile
• 5-Pyrimidinecarbonitrile, 1-cyclohexyl-1,2,3,4-tetrahydro-2,4-dioxo-
• 1-Cyclohexyl-2,4-dioxo-1,2,3,4-tetrahydro-pyrimidine-5-carbonitrile

1-Cyclohexyl-1,2,3,4-tetrahydro-2,4-dioxopyrimidine-5-carbonitrile

CAS: 6301-31-1

Formula: C₁₁H₁₃N₃O₂

Purity: 97%

Molecular weight: 219.2398

Ref: IN-DA00EDAG